C21H21F2NO5 — CID 8837014
[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 8837014) has the molecular formula C21H21F2NO5 and a molecular weight of 405.40 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8837014 |
| Molecular Formula | C21H21F2NO5 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)N[C@H](C)c2ccccc2)c1OC(F)F |
| InChI | InChI=1S/C21H21F2NO5/c1-14(15-7-4-3-5-8-15)24-18(25)13-28-19(26)12-11-16-9-6-10-17(27-2)20(16)29-21(22)23/h3-12,14,21H,13H2,1-2H3,(H,24,25)/b12-11+/t14-/m1/s1 |
| InChIKey | HPOCQUXURCIXGB-GCZGRYASSA-N |
| XLogP | 3.73 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|