C17H13ClF2O5S — CID 8837025
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate (PubChem CID 8837025) has the molecular formula C17H13ClF2O5S and a molecular weight of 402.80 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 8837025 |
| Molecular Formula | C17H13ClF2O5S |
| Molecular Weight | 402.80 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)c2ccc(Cl)s2)c1OC(F)F |
| InChI | InChI=1S/C17H13ClF2O5S/c1-23-12-4-2-3-10(16(12)25-17(19)20)5-8-15(22)24-9-11(21)13-6-7-14(18)26-13/h2-8,17H,9H2,1H3/b8-5+ |
| InChIKey | DBDMVGFRVNQZMK-VMPITWQZSA-N |
| XLogP | 4.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.80 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|