C18H17ClO5S — CID 7791065
[2-(5-chlorothiophen-2-yl)-2-oxoethyl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 7791065) has the molecular formula C18H17ClO5S and a molecular weight of 380.85 g/mol. Its IUPAC name is [2-(5-chlorothiophen-2-yl)-2-oxoethyl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7791065 |
| Molecular Formula | C18H17ClO5S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | [2-(5-chlorothiophen-2-yl)-2-oxoethyl] (E)-3-(3-ethoxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(/C=C/C(=O)OCC(=O)c2ccc(Cl)s2)ccc1OC |
| InChI | InChI=1S/C18H17ClO5S/c1-3-23-15-10-12(4-6-14(15)22-2)5-9-18(21)24-11-13(20)16-7-8-17(19)25-16/h4-10H,3,11H2,1-2H3/b9-5+ |
| InChIKey | XITWCVRTVJIROO-WEVVVXLNSA-N |
| XLogP | 4.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|