C28H30N2O5 — CID 6012564
[2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 6012564) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is [2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6012564 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | [2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)Nc2ccc(N(c3ccccc3)C(C)C)cc2)c1OC |
| InChI | InChI=1S/C28H30N2O5/c1-20(2)30(23-10-6-5-7-11-23)24-16-14-22(15-17-24)29-26(31)19-35-27(32)18-13-21-9-8-12-25(33-3)28(21)34-4/h5-18,20H,19H2,1-4H3,(H,29,31)/b18-13+ |
| InChIKey | XKETUDPOLKMYMM-QGOAFFKASA-N |
| XLogP | 5.45 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|