C24H24N2O4 — CID 4655186
[2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] 3-(furan-2-yl)prop-2-enoate (PubChem CID 4655186) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is [2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] 3-(furan-2-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] 3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 4655186 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] 3-(furan-2-yl)prop-2-enoate |
| SMILES | CC(C)N(c1ccccc1)c1ccc(NC(=O)COC(=O)C=Cc2ccco2)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-18(2)26(20-7-4-3-5-8-20)21-12-10-19(11-13-21)25-23(27)17-30-24(28)15-14-22-9-6-16-29-22/h3-16,18H,17H2,1-2H3,(H,25,27) |
| InChIKey | FUMNHIYTAWSIDN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|