C26H25FN2O3 — CID 5175698
[2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] 3-(3-fluorophenyl)prop-2-enoate (PubChem CID 5175698) has the molecular formula C26H25FN2O3 and a molecular weight of 432.50 g/mol. Its IUPAC name is [2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] 3-(3-fluorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] 3-(3-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 5175698 |
| Molecular Formula | C26H25FN2O3 |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | [2-oxo-2-[4-(N-propan-2-ylanilino)anilino]ethyl] 3-(3-fluorophenyl)prop-2-enoate |
| SMILES | CC(C)N(c1ccccc1)c1ccc(NC(=O)COC(=O)C=Cc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C26H25FN2O3/c1-19(2)29(23-9-4-3-5-10-23)24-14-12-22(13-15-24)28-25(30)18-32-26(31)16-11-20-7-6-8-21(27)17-20/h3-17,19H,18H2,1-2H3,(H,28,30) |
| InChIKey | AUTYSBPLCFSOEA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|