C19H18FNO5 — CID 2586766
[2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 2586766) has the molecular formula C19H18FNO5 and a molecular weight of 359.35 g/mol. Its IUPAC name is [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2586766 |
| Molecular Formula | C19H18FNO5 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [2-(3-fluoroanilino)-2-oxoethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)Nc2cccc(F)c2)c1OC |
| InChI | InChI=1S/C19H18FNO5/c1-24-16-8-3-5-13(19(16)25-2)9-10-18(23)26-12-17(22)21-15-7-4-6-14(20)11-15/h3-11H,12H2,1-2H3,(H,21,22)/b10-9+ |
| InChIKey | KFQDWPNVMJHTGR-MDZDMXLPSA-N |
| XLogP | 3.04 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|