C21H31NO5 — CID 9491470
[2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate (PubChem CID 9491470) has the molecular formula C21H31NO5 and a molecular weight of 377.48 g/mol. Its IUPAC name is [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9491470 |
| Molecular Formula | C21H31NO5 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [2-oxo-2-(2,4,4-trimethylpentan-2-ylamino)ethyl] (E)-3-(2,3-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cccc(/C=C/C(=O)OCC(=O)NC(C)(C)CC(C)(C)C)c1OC |
| InChI | InChI=1S/C21H31NO5/c1-20(2,3)14-21(4,5)22-17(23)13-27-18(24)12-11-15-9-8-10-16(25-6)19(15)26-7/h8-12H,13-14H2,1-7H3,(H,22,23)/b12-11+ |
| InChIKey | WBCOBVVTLXIZCL-VAWYXSNFSA-N |
| XLogP | 3.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|