C21H27N2O3+ — CID 8936521
[(2R)-2-[[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]-2-phenylethyl]-dimethylazanium (PubChem CID 8936521) has the molecular formula C21H27N2O3+ and a molecular weight of 355.46 g/mol. Its IUPAC name is [(2R)-2-[[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]-2-phenylethyl]-dimethylazanium.
| Compound Name | [(2R)-2-[[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]-2-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8936521 |
| Molecular Formula | C21H27N2O3+ |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | [(2R)-2-[[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]amino]-2-phenylethyl]-dimethylazanium |
| SMILES | COc1cccc(/C=C/C(=O)N[C@@H](C[NH+](C)C)c2ccccc2)c1OC |
| InChI | InChI=1S/C21H26N2O3/c1-23(2)15-18(16-9-6-5-7-10-16)22-20(24)14-13-17-11-8-12-19(25-3)21(17)26-4/h5-14,18H,15H2,1-4H3,(H,22,24)/p+1/b14-13+/t18-/m0/s1 |
| InChIKey | RGWFIEPBWYPBLS-JKGDOXCYSA-O |
| XLogP | 1.72 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|