C19H20BrNO3 — CID 9220137
(E)-N-[(1R)-1-(2-bromophenyl)ethyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide (PubChem CID 9220137) has the molecular formula C19H20BrNO3 and a molecular weight of 390.28 g/mol. Its IUPAC name is (E)-N-[(1R)-1-(2-bromophenyl)ethyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(1R)-1-(2-bromophenyl)ethyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9220137 |
| Molecular Formula | C19H20BrNO3 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | (E)-N-[(1R)-1-(2-bromophenyl)ethyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)N[C@H](C)c2ccccc2Br)c1OC |
| InChI | InChI=1S/C19H20BrNO3/c1-13(15-8-4-5-9-16(15)20)21-18(22)12-11-14-7-6-10-17(23-2)19(14)24-3/h4-13H,1-3H3,(H,21,22)/b12-11+/t13-/m1/s1 |
| InChIKey | FIHKVQGVPDGXCW-XZHRJIJLSA-N |
| XLogP | 4.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|