C19H28N2O — CID 87025920
(E)-3-(2,4-dimethylphenyl)-N-(2-methyl-3-pyrrolidin-1-ylpropyl)prop-2-enamide (PubChem CID 87025920) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-(2-methyl-3-pyrrolidin-1-ylpropyl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-(2-methyl-3-pyrrolidin-1-ylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 87025920 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-(2-methyl-3-pyrrolidin-1-ylpropyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NCC(C)CN2CCCC2)c(C)c1 |
| InChI | InChI=1S/C19H28N2O/c1-15-6-7-18(17(3)12-15)8-9-19(22)20-13-16(2)14-21-10-4-5-11-21/h6-9,12,16H,4-5,10-11,13-14H2,1-3H3,(H,20,22)/b9-8+ |
| InChIKey | IFYKGJAGZHNCMJ-CMDGGOBGSA-N |
| XLogP | 3.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|