C18H27NO2 — CID 103843227
(E)-3-(2,4-dimethylphenyl)-N-[2-ethyl-2-(hydroxymethyl)butyl]prop-2-enamide (PubChem CID 103843227) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-[2-ethyl-2-(hydroxymethyl)butyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-[2-ethyl-2-(hydroxymethyl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 103843227 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-[2-ethyl-2-(hydroxymethyl)butyl]prop-2-enamide |
| SMILES | CCC(CC)(CO)CNC(=O)/C=C/c1ccc(C)cc1C |
| InChI | InChI=1S/C18H27NO2/c1-5-18(6-2,13-20)12-19-17(21)10-9-16-8-7-14(3)11-15(16)4/h7-11,20H,5-6,12-13H2,1-4H3,(H,19,21)/b10-9+ |
| InChIKey | LWLRNAMSZPUURV-MDZDMXLPSA-N |
| XLogP | 3.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|