C15H21NO2 — CID 106842991
(E)-3-(2,4-dimethylphenyl)-N-(4-hydroxybutyl)prop-2-enamide (PubChem CID 106842991) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-(4-hydroxybutyl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-(4-hydroxybutyl)prop-2-enamide |
|---|---|
| PubChem CID | 106842991 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-(4-hydroxybutyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)NCCCCO)c(C)c1 |
| InChI | InChI=1S/C15H21NO2/c1-12-5-6-14(13(2)11-12)7-8-15(18)16-9-3-4-10-17/h5-8,11,17H,3-4,9-10H2,1-2H3,(H,16,18)/b8-7+ |
| InChIKey | GYTCZJKMXSJRSI-BQYQJAHWSA-N |
| XLogP | 2.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|