C14H16BrNO3 — CID 43239299
4-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]butanoic acid (PubChem CID 43239299) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is 4-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]butanoic acid.
| Compound Name | 4-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43239299 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 4-[[(E)-3-(2-bromo-4-methylphenyl)prop-2-enoyl]amino]butanoic acid |
| SMILES | Cc1ccc(/C=C/C(=O)NCCCC(=O)O)c(Br)c1 |
| InChI | InChI=1S/C14H16BrNO3/c1-10-4-5-11(12(15)9-10)6-7-13(17)16-8-2-3-14(18)19/h4-7,9H,2-3,8H2,1H3,(H,16,17)(H,18,19)/b7-6+ |
| InChIKey | HXQXSBNBDOQIBJ-VOTSOKGWSA-N |
| XLogP | 2.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|