C15H18BrNO3 — CID 77058340
3-[3-(2-bromo-4-methylphenyl)prop-2-enoylamino]-3-methylbutanoic acid (PubChem CID 77058340) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is 3-[3-(2-bromo-4-methylphenyl)prop-2-enoylamino]-3-methylbutanoic acid.
| Compound Name | 3-[3-(2-bromo-4-methylphenyl)prop-2-enoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 77058340 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 3-[3-(2-bromo-4-methylphenyl)prop-2-enoylamino]-3-methylbutanoic acid |
| SMILES | Cc1ccc(C=CC(=O)NC(C)(C)CC(=O)O)c(Br)c1 |
| InChI | InChI=1S/C15H18BrNO3/c1-10-4-5-11(12(16)8-10)6-7-13(18)17-15(2,3)9-14(19)20/h4-8H,9H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | MDSBTLYHNSBHME-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|