C16H20BrNO3 — CID 78975802
(2R)-2-[3-(2-bromo-4-methylphenyl)prop-2-enoylamino]-4-methylpentanoic acid (PubChem CID 78975802) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is (2R)-2-[3-(2-bromo-4-methylphenyl)prop-2-enoylamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[3-(2-bromo-4-methylphenyl)prop-2-enoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 78975802 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (2R)-2-[3-(2-bromo-4-methylphenyl)prop-2-enoylamino]-4-methylpentanoic acid |
| SMILES | Cc1ccc(C=CC(=O)N[C@H](CC(C)C)C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C16H20BrNO3/c1-10(2)8-14(16(20)21)18-15(19)7-6-12-5-4-11(3)9-13(12)17/h4-7,9-10,14H,8H2,1-3H3,(H,18,19)(H,20,21)/t14-/m1/s1 |
| InChIKey | OYDAGWGIHIWFBQ-CQSZACIVSA-N |
| XLogP | 3.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|