C14H19NO3S — CID 43091779
4-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]pentanoic acid (PubChem CID 43091779) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 4-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]pentanoic acid.
| Compound Name | 4-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 43091779 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]pentanoic acid |
| SMILES | Cc1ccc(/C=C/C(=O)NC(CC(C)C)C(=O)O)s1 |
| InChI | InChI=1S/C14H19NO3S/c1-9(2)8-12(14(17)18)15-13(16)7-6-11-5-4-10(3)19-11/h4-7,9,12H,8H2,1-3H3,(H,15,16)(H,17,18)/b7-6+ |
| InChIKey | XORWUSUTJZNRFW-VOTSOKGWSA-N |
| XLogP | 2.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|