C15H27N5O3S — CID 159425816
methanamine;(2S)-N-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]butanediamide (PubChem CID 159425816) has the molecular formula C15H27N5O3S and a molecular weight of 357.48 g/mol. Its IUPAC name is methanamine;(2S)-N-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]butanediamide.
| Compound Name | methanamine;(2S)-N-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]butanediamide |
|---|---|
| PubChem CID | 159425816 |
| Molecular Formula | C15H27N5O3S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | methanamine;(2S)-N-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]butanediamide |
| SMILES | CN.CN.CNC(=O)[C@H](CC(N)=O)NC(=O)/C=C/c1ccc(C)s1 |
| InChI | InChI=1S/C13H17N3O3S.2CH5N/c1-8-3-4-9(20-8)5-6-12(18)16-10(7-11(14)17)13(19)15-2;2*1-2/h3-6,10H,7H2,1-2H3,(H2,14,17)(H,15,19)(H,16,18);2*2H2,1H3/b6-5+;;/t10-;;/m0../s1 |
| InChIKey | LQIJLBVTTBDBNU-VVYNGRBTSA-N |
| XLogP | -0.67 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|