C14H21NOS — CID 115612726
(E)-N-(2-ethylbutyl)-3-(5-methylthiophen-2-yl)prop-2-enamide (PubChem CID 115612726) has the molecular formula C14H21NOS and a molecular weight of 251.40 g/mol. Its IUPAC name is (E)-N-(2-ethylbutyl)-3-(5-methylthiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-ethylbutyl)-3-(5-methylthiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 115612726 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (E)-N-(2-ethylbutyl)-3-(5-methylthiophen-2-yl)prop-2-enamide |
| SMILES | CCC(CC)CNC(=O)/C=C/c1ccc(C)s1 |
| InChI | InChI=1S/C14H21NOS/c1-4-12(5-2)10-15-14(16)9-8-13-7-6-11(3)17-13/h6-9,12H,4-5,10H2,1-3H3,(H,15,16)/b9-8+ |
| InChIKey | UOKCJKUVQNPOQR-CMDGGOBGSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|