C17H29N5O3 — CID 162183869
(2S)-2-[[2-(2-ethenylphenyl)acetyl]amino]-N-methylbutanediamide;methanamine (PubChem CID 162183869) has the molecular formula C17H29N5O3 and a molecular weight of 351.45 g/mol. Its IUPAC name is (2S)-2-[[2-(2-ethenylphenyl)acetyl]amino]-N-methylbutanediamide;methanamine.
| Compound Name | (2S)-2-[[2-(2-ethenylphenyl)acetyl]amino]-N-methylbutanediamide;methanamine |
|---|---|
| PubChem CID | 162183869 |
| Molecular Formula | C17H29N5O3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (2S)-2-[[2-(2-ethenylphenyl)acetyl]amino]-N-methylbutanediamide;methanamine |
| SMILES | C=Cc1ccccc1CC(=O)N[C@@H](CC(N)=O)C(=O)NC.CN.CN |
| InChI | InChI=1S/C15H19N3O3.2CH5N/c1-3-10-6-4-5-7-11(10)8-14(20)18-12(9-13(16)19)15(21)17-2;2*1-2/h3-7,12H,1,8-9H2,2H3,(H2,16,19)(H,17,21)(H,18,20);2*2H2,1H3/t12-;;/m0../s1 |
| InChIKey | ZPKCRAXDLPOCGU-LTCKWSDVSA-N |
| XLogP | -0.87 |
| TPSA | 153.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |