C19H21N3O4 — CID 58709545
(2S)-N-methyl-2-[[2-(3-phenylphenoxy)acetyl]amino]butanediamide (PubChem CID 58709545) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is (2S)-N-methyl-2-[[2-(3-phenylphenoxy)acetyl]amino]butanediamide.
| Compound Name | (2S)-N-methyl-2-[[2-(3-phenylphenoxy)acetyl]amino]butanediamide |
|---|---|
| PubChem CID | 58709545 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (2S)-N-methyl-2-[[2-(3-phenylphenoxy)acetyl]amino]butanediamide |
| SMILES | CNC(=O)[C@H](CC(N)=O)NC(=O)COc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C19H21N3O4/c1-21-19(25)16(11-17(20)23)22-18(24)12-26-15-9-5-8-14(10-15)13-6-3-2-4-7-13/h2-10,16H,11-12H2,1H3,(H2,20,23)(H,21,25)(H,22,24)/t16-/m0/s1 |
| InChIKey | GKXRDBGXSHLDJQ-INIZCTEOSA-N |
| XLogP | 0.84 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |