C23H21N3O4 — CID 126007670
phenyl N-[(2S)-4-amino-1,4-dioxo-1-(4-phenylanilino)butan-2-yl]carbamate (PubChem CID 126007670) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is phenyl N-[(2S)-4-amino-1,4-dioxo-1-(4-phenylanilino)butan-2-yl]carbamate.
| Compound Name | phenyl N-[(2S)-4-amino-1,4-dioxo-1-(4-phenylanilino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 126007670 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | phenyl N-[(2S)-4-amino-1,4-dioxo-1-(4-phenylanilino)butan-2-yl]carbamate |
| SMILES | NC(=O)C[C@H](NC(=O)Oc1ccccc1)C(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21N3O4/c24-21(27)15-20(26-23(29)30-19-9-5-2-6-10-19)22(28)25-18-13-11-17(12-14-18)16-7-3-1-4-8-16/h1-14,20H,15H2,(H2,24,27)(H,25,28)(H,26,29)/t20-/m0/s1 |
| InChIKey | GHPWERHUPSOSIU-FQEVSTJZSA-N |
| XLogP | 3.32 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |