C39H30N2O4 — CID 67179519
(4-phenylphenyl) N-[4-[[4-[(4-phenylphenoxy)carbonylamino]phenyl]methyl]phenyl]carbamate (PubChem CID 67179519) has the molecular formula C39H30N2O4 and a molecular weight of 590.68 g/mol. Its IUPAC name is (4-phenylphenyl) N-[4-[[4-[(4-phenylphenoxy)carbonylamino]phenyl]methyl]phenyl]carbamate.
| Compound Name | (4-phenylphenyl) N-[4-[[4-[(4-phenylphenoxy)carbonylamino]phenyl]methyl]phenyl]carbamate |
|---|---|
| PubChem CID | 67179519 |
| Molecular Formula | C39H30N2O4 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | (4-phenylphenyl) N-[4-[[4-[(4-phenylphenoxy)carbonylamino]phenyl]methyl]phenyl]carbamate |
| SMILES | O=C(Nc1ccc(Cc2ccc(NC(=O)Oc3ccc(-c4ccccc4)cc3)cc2)cc1)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C39H30N2O4/c42-38(44-36-23-15-32(16-24-36)30-7-3-1-4-8-30)40-34-19-11-28(12-20-34)27-29-13-21-35(22-14-29)41-39(43)45-37-25-17-33(18-26-37)31-9-5-2-6-10-31/h1-26H,27H2,(H,40,42)(H,41,43) |
| InChIKey | JVGFXEZSDQFTBU-UHFFFAOYSA-N |
| XLogP | 9.83 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |