About (4-phenylphenyl) N-benzylcarbamate
(4-phenylphenyl) N-benzylcarbamate (PubChem CID 25174478) has the molecular formula C20H17NO2
and a molecular weight of 303.36 g/mol. Its IUPAC name is (4-phenylphenyl) N-benzylcarbamate.
Molecular Properties
| Compound Name | (4-phenylphenyl) N-benzylcarbamate |
| PubChem CID | 25174478 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (4-phenylphenyl) N-benzylcarbamate |
| SMILES | O=C(NCc1ccccc1)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H17NO2/c22-20(21-15-16-7-3-1-4-8-16)23-19-13-11-18(12-14-19)17-9-5-2-6-10-17/h1-14H,15H2,(H,21,22) |
| InChIKey | SZVFOOLCCNSXQG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-phenylphenyl) N-benzylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylphenyl) N-benzylcarbamate?
The IUPAC name of (4-phenylphenyl) N-benzylcarbamate (CID 25174478) is (4-phenylphenyl) N-benzylcarbamate.
What is the SMILES notation for (4-phenylphenyl) N-benzylcarbamate?
The canonical SMILES for (4-phenylphenyl) N-benzylcarbamate is O=C(NCc1ccccc1)Oc1ccc(-c2ccccc2)cc1.
What is the InChIKey of (4-phenylphenyl) N-benzylcarbamate?
The InChIKey is SZVFOOLCCNSXQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17NO2/c22-20(21-15-16-7-3-1-4-8-16)23-19-13-11-18(12-14-19)17-9-5-2-6-10-17/h1-14H,15H2,(H,21,22).
What are the key properties of (4-phenylphenyl) N-benzylcarbamate?
(4-phenylphenyl) N-benzylcarbamate has a molecular weight of 303.36 g/mol, XLogP of 4.64, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylphenyl) N-benzylcarbamate is sourced from PubChem (CID 25174478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).