C13H17N3O3S — CID 58709468
(2S)-N-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]butanediamide (PubChem CID 58709468) has the molecular formula C13H17N3O3S and a molecular weight of 295.36 g/mol. Its IUPAC name is (2S)-N-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]butanediamide.
| Compound Name | (2S)-N-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]butanediamide |
|---|---|
| PubChem CID | 58709468 |
| Molecular Formula | C13H17N3O3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (2S)-N-methyl-2-[[(E)-3-(5-methylthiophen-2-yl)prop-2-enoyl]amino]butanediamide |
| SMILES | CNC(=O)[C@H](CC(N)=O)NC(=O)/C=C/c1ccc(C)s1 |
| InChI | InChI=1S/C13H17N3O3S/c1-8-3-4-9(20-8)5-6-12(18)16-10(7-11(14)17)13(19)15-2/h3-6,10H,7H2,1-2H3,(H2,14,17)(H,15,19)(H,16,18)/b6-5+/t10-/m0/s1 |
| InChIKey | WCNGJHPAXYFYEF-PORFMDCZSA-N |
| XLogP | 0.18 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|