C15H15NO2S — CID 74626738
3-(5-methylthiophen-2-yl)-N-phenylmethoxyprop-2-enamide (PubChem CID 74626738) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 3-(5-methylthiophen-2-yl)-N-phenylmethoxyprop-2-enamide.
| Compound Name | 3-(5-methylthiophen-2-yl)-N-phenylmethoxyprop-2-enamide |
|---|---|
| PubChem CID | 74626738 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 3-(5-methylthiophen-2-yl)-N-phenylmethoxyprop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)NOCc2ccccc2)s1 |
| InChI | InChI=1S/C15H15NO2S/c1-12-7-8-14(19-12)9-10-15(17)16-18-11-13-5-3-2-4-6-13/h2-10H,11H2,1H3,(H,16,17) |
| InChIKey | RJWGOPANUYDGRE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|