C19H29NO2 — CID 23017898
(E)-3-(4-hydroxy-2-methylphenyl)-N-nonylprop-2-enamide (PubChem CID 23017898) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (E)-3-(4-hydroxy-2-methylphenyl)-N-nonylprop-2-enamide.
| Compound Name | (E)-3-(4-hydroxy-2-methylphenyl)-N-nonylprop-2-enamide |
|---|---|
| PubChem CID | 23017898 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (E)-3-(4-hydroxy-2-methylphenyl)-N-nonylprop-2-enamide |
| SMILES | CCCCCCCCCNC(=O)/C=C/c1ccc(O)cc1C |
| InChI | InChI=1S/C19H29NO2/c1-3-4-5-6-7-8-9-14-20-19(22)13-11-17-10-12-18(21)15-16(17)2/h10-13,15,21H,3-9,14H2,1-2H3,(H,20,22)/b13-11+ |
| InChIKey | KVMFSFDQBYDPTL-ACCUITESSA-N |
| XLogP | 4.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|