C20H30ClNO — CID 3474839
3-(2-chlorophenyl)-N-undecylprop-2-enamide (PubChem CID 3474839) has the molecular formula C20H30ClNO and a molecular weight of 335.92 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-undecylprop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-undecylprop-2-enamide |
|---|---|
| PubChem CID | 3474839 |
| Molecular Formula | C20H30ClNO |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 3-(2-chlorophenyl)-N-undecylprop-2-enamide |
| SMILES | CCCCCCCCCCCNC(=O)C=Cc1ccccc1Cl |
| InChI | InChI=1S/C20H30ClNO/c1-2-3-4-5-6-7-8-9-12-17-22-20(23)16-15-18-13-10-11-14-19(18)21/h10-11,13-16H,2-9,12,17H2,1H3,(H,22,23) |
| InChIKey | HZJRHJZFINTESN-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|