C12H10ClNO — CID 131848081
3-(2-chlorophenyl)-N-prop-2-ynylprop-2-enamide (PubChem CID 131848081) has the molecular formula C12H10ClNO and a molecular weight of 219.67 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-prop-2-ynylprop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-prop-2-ynylprop-2-enamide |
|---|---|
| PubChem CID | 131848081 |
| Molecular Formula | C12H10ClNO |
| Molecular Weight | 219.67 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 3-(2-chlorophenyl)-N-prop-2-ynylprop-2-enamide |
| SMILES | C#CCNC(=O)C=Cc1ccccc1Cl |
| InChI | InChI=1S/C12H10ClNO/c1-2-9-14-12(15)8-7-10-5-3-4-6-11(10)13/h1,3-8H,9H2,(H,14,15) |
| InChIKey | YHTXBEFKWFIKOF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.67 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|