C19H21ClN2O — CID 99996150
(E)-3-(2-chlorophenyl)-N-[3-(N-methylanilino)propyl]prop-2-enamide (PubChem CID 99996150) has the molecular formula C19H21ClN2O and a molecular weight of 328.84 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[3-(N-methylanilino)propyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[3-(N-methylanilino)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 99996150 |
| Molecular Formula | C19H21ClN2O |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[3-(N-methylanilino)propyl]prop-2-enamide |
| SMILES | CN(CCCNC(=O)/C=C/c1ccccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C19H21ClN2O/c1-22(17-9-3-2-4-10-17)15-7-14-21-19(23)13-12-16-8-5-6-11-18(16)20/h2-6,8-13H,7,14-15H2,1H3,(H,21,23)/b13-12+ |
| InChIKey | AFKWAZPBYDOUAY-OUKQBFOZSA-N |
| XLogP | 4.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|