C17H23NO2 — CID 115699885
(E)-3-(2,4-dimethylphenyl)-N-[2-(2-methylprop-2-enoxy)ethyl]prop-2-enamide (PubChem CID 115699885) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is (E)-3-(2,4-dimethylphenyl)-N-[2-(2-methylprop-2-enoxy)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dimethylphenyl)-N-[2-(2-methylprop-2-enoxy)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 115699885 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (E)-3-(2,4-dimethylphenyl)-N-[2-(2-methylprop-2-enoxy)ethyl]prop-2-enamide |
| SMILES | C=C(C)COCCNC(=O)/C=C/c1ccc(C)cc1C |
| InChI | InChI=1S/C17H23NO2/c1-13(2)12-20-10-9-18-17(19)8-7-16-6-5-14(3)11-15(16)4/h5-8,11H,1,9-10,12H2,2-4H3,(H,18,19)/b8-7+ |
| InChIKey | DZCNLQXPJGZYHQ-BQYQJAHWSA-N |
| XLogP | 3.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|