C18H23N3O2 — CID 111720102
3-(2,4-dimethylphenyl)-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]prop-2-enamide (PubChem CID 111720102) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-(2,4-dimethylphenyl)-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]prop-2-enamide.
| Compound Name | 3-(2,4-dimethylphenyl)-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 111720102 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-(2,4-dimethylphenyl)-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)NCC(C)(O)c2cnn(C)c2)c(C)c1 |
| InChI | InChI=1S/C18H23N3O2/c1-13-5-6-15(14(2)9-13)7-8-17(22)19-12-18(3,23)16-10-20-21(4)11-16/h5-11,23H,12H2,1-4H3,(H,19,22) |
| InChIKey | YRJAICWTTIOCLL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|