C16H21Cl2NO2 — CID 106252387
(E)-3-(2,6-dichlorophenyl)-N-[2-ethyl-2-(hydroxymethyl)butyl]prop-2-enamide (PubChem CID 106252387) has the molecular formula C16H21Cl2NO2 and a molecular weight of 330.25 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-N-[2-ethyl-2-(hydroxymethyl)butyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-N-[2-ethyl-2-(hydroxymethyl)butyl]prop-2-enamide |
|---|---|
| PubChem CID | 106252387 |
| Molecular Formula | C16H21Cl2NO2 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-N-[2-ethyl-2-(hydroxymethyl)butyl]prop-2-enamide |
| SMILES | CCC(CC)(CO)CNC(=O)/C=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C16H21Cl2NO2/c1-3-16(4-2,11-20)10-19-15(21)9-8-12-13(17)6-5-7-14(12)18/h5-9,20H,3-4,10-11H2,1-2H3,(H,19,21)/b9-8+ |
| InChIKey | SUIAZEBNFIJPMH-CMDGGOBGSA-N |
| XLogP | 3.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|