C15H19ClFNO2 — CID 103825021
(E)-3-(2-chloro-6-fluorophenyl)-N-(4-hydroxy-2,2-dimethylbutyl)prop-2-enamide (PubChem CID 103825021) has the molecular formula C15H19ClFNO2 and a molecular weight of 299.77 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-(4-hydroxy-2,2-dimethylbutyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(4-hydroxy-2,2-dimethylbutyl)prop-2-enamide |
|---|---|
| PubChem CID | 103825021 |
| Molecular Formula | C15H19ClFNO2 |
| Molecular Weight | 299.77 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(4-hydroxy-2,2-dimethylbutyl)prop-2-enamide |
| SMILES | CC(C)(CCO)CNC(=O)/C=C/c1c(F)cccc1Cl |
| InChI | InChI=1S/C15H19ClFNO2/c1-15(2,8-9-19)10-18-14(20)7-6-11-12(16)4-3-5-13(11)17/h3-7,19H,8-10H2,1-2H3,(H,18,20)/b7-6+ |
| InChIKey | HNBJJFZQTKCQSG-VOTSOKGWSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|