C12H11ClF3NO2 — CID 103769871
(E)-3-(2-chloro-6-fluorophenyl)-N-(3,3-difluoro-2-hydroxypropyl)prop-2-enamide (PubChem CID 103769871) has the molecular formula C12H11ClF3NO2 and a molecular weight of 293.67 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-(3,3-difluoro-2-hydroxypropyl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(3,3-difluoro-2-hydroxypropyl)prop-2-enamide |
|---|---|
| PubChem CID | 103769871 |
| Molecular Formula | C12H11ClF3NO2 |
| Molecular Weight | 293.67 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(3,3-difluoro-2-hydroxypropyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1c(F)cccc1Cl)NCC(O)C(F)F |
| InChI | InChI=1S/C12H11ClF3NO2/c13-8-2-1-3-9(14)7(8)4-5-11(19)17-6-10(18)12(15)16/h1-5,10,12,18H,6H2,(H,17,19)/b5-4+ |
| InChIKey | QNPHONJYLWYDIM-SNAWJCMRSA-N |
| XLogP | 2.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.67 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|