C15H22N2O2 — CID 103843405
(E)-N-[2-ethyl-2-(hydroxymethyl)butyl]-3-pyridin-3-ylprop-2-enamide (PubChem CID 103843405) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (E)-N-[2-ethyl-2-(hydroxymethyl)butyl]-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-[2-ethyl-2-(hydroxymethyl)butyl]-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 103843405 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (E)-N-[2-ethyl-2-(hydroxymethyl)butyl]-3-pyridin-3-ylprop-2-enamide |
| SMILES | CCC(CC)(CO)CNC(=O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C15H22N2O2/c1-3-15(4-2,12-18)11-17-14(19)8-7-13-6-5-9-16-10-13/h5-10,18H,3-4,11-12H2,1-2H3,(H,17,19)/b8-7+ |
| InChIKey | YJVVXVAABAZQSM-BQYQJAHWSA-N |
| XLogP | 2.01 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|