C10H12N2O2 — CID 43416816
(E)-N-(2-hydroxyethyl)-3-pyridin-3-ylprop-2-enamide (PubChem CID 43416816) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is (E)-N-(2-hydroxyethyl)-3-pyridin-3-ylprop-2-enamide.
| Compound Name | (E)-N-(2-hydroxyethyl)-3-pyridin-3-ylprop-2-enamide |
|---|---|
| PubChem CID | 43416816 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (E)-N-(2-hydroxyethyl)-3-pyridin-3-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccnc1)NCCO |
| InChI | InChI=1S/C10H12N2O2/c13-7-6-12-10(14)4-3-9-2-1-5-11-8-9/h1-5,8,13H,6-7H2,(H,12,14)/b4-3+ |
| InChIKey | AJPVVLYEGNBBKU-ONEGZZNKSA-N |
| XLogP | 0.20 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|