C24H26N2O4 — CID 102001285
(E)-3-(4-hydroxyphenyl)-N-[(1S,2S)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]cyclohexyl]prop-2-enamide (PubChem CID 102001285) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is (E)-3-(4-hydroxyphenyl)-N-[(1S,2S)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(4-hydroxyphenyl)-N-[(1S,2S)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 102001285 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (E)-3-(4-hydroxyphenyl)-N-[(1S,2S)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]cyclohexyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(O)cc1)N[C@H]1CCCC[C@@H]1NC(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C24H26N2O4/c27-19-11-5-17(6-12-19)9-15-23(29)25-21-3-1-2-4-22(21)26-24(30)16-10-18-7-13-20(28)14-8-18/h5-16,21-22,27-28H,1-4H2,(H,25,29)(H,26,30)/b15-9+,16-10+/t21-,22-/m0/s1 |
| InChIKey | XZYQCASREYCILV-WVOLPMMFSA-N |
| XLogP | 3.37 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|