C15H17NO4 — CID 77110079
3-[3-(4-hydroxyphenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid (PubChem CID 77110079) has the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-[3-(4-hydroxyphenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid.
| Compound Name | 3-[3-(4-hydroxyphenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 77110079 |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-[3-(4-hydroxyphenyl)prop-2-enoylamino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(O)cc1)NC1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C15H17NO4/c17-13-6-1-10(2-7-13)3-8-14(18)16-12-5-4-11(9-12)15(19)20/h1-3,6-8,11-12,17H,4-5,9H2,(H,16,18)(H,19,20) |
| InChIKey | KWFZZLJXWRQRDD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|