C18H23N3O3 — CID 138497378
(1S)-2-[[2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]cyclohexane-1-carboxamide (PubChem CID 138497378) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is (1S)-2-[[2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]cyclohexane-1-carboxamide.
| Compound Name | (1S)-2-[[2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 138497378 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (1S)-2-[[2-[[(E)-3-phenylprop-2-enoyl]amino]acetyl]amino]cyclohexane-1-carboxamide |
| SMILES | NC(=O)[C@H]1CCCCC1NC(=O)CNC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C18H23N3O3/c19-18(24)14-8-4-5-9-15(14)21-17(23)12-20-16(22)11-10-13-6-2-1-3-7-13/h1-3,6-7,10-11,14-15H,4-5,8-9,12H2,(H2,19,24)(H,20,22)(H,21,23)/b11-10+/t14-,15?/m0/s1 |
| InChIKey | KOELGJKRTYEDCR-IYQOPPGGSA-N |
| XLogP | 0.98 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|