C18H25N3O2 — CID 129442354
(Z)-N-[2-[[(1R,2R)-2-(dimethylamino)cyclopentyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 129442354) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (Z)-N-[2-[[(1R,2R)-2-(dimethylamino)cyclopentyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (Z)-N-[2-[[(1R,2R)-2-(dimethylamino)cyclopentyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 129442354 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (Z)-N-[2-[[(1R,2R)-2-(dimethylamino)cyclopentyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | CN(C)[C@@H]1CCC[C@H]1NC(=O)CNC(=O)/C=C\c1ccccc1 |
| InChI | InChI=1S/C18H25N3O2/c1-21(2)16-10-6-9-15(16)20-18(23)13-19-17(22)12-11-14-7-4-3-5-8-14/h3-5,7-8,11-12,15-16H,6,9-10,13H2,1-2H3,(H,19,22)(H,20,23)/b12-11-/t15-,16-/m1/s1 |
| InChIKey | GKCPWLCZHXSSAJ-BSQDILAGSA-N |
| XLogP | 1.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|