About N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide
N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide (PubChem CID 98775179) has the molecular formula C10H21N3O2S
and a molecular weight of 247.36 g/mol. Its IUPAC name is N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide |
| PubChem CID | 98775179 |
| Molecular Formula | C10H21N3O2S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide |
| SMILES | C[C@H]1CN(C)C[C@H]1NS(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C10H21N3O2S/c1-9-7-12(2)8-10(9)11-16(14,15)13-5-3-4-6-13/h9-11H,3-8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | YSPAKYFXOOJNIR-VHSXEESVSA-N |
| XLogP | -0.13 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide?
The IUPAC name of N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide (CID 98775179) is N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide.
What is the SMILES notation for N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide?
The canonical SMILES for N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide is C[C@H]1CN(C)C[C@H]1NS(=O)(=O)N1CCCC1.
What is the InChIKey of N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide?
The InChIKey is YSPAKYFXOOJNIR-VHSXEESVSA-N. The full InChI is InChI=1S/C10H21N3O2S/c1-9-7-12(2)8-10(9)11-16(14,15)13-5-3-4-6-13/h9-11H,3-8H2,1-2H3/t9-,10+/m0/s1.
What are the key properties of N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide?
N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide has a molecular weight of 247.36 g/mol, XLogP of -0.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4S)-1,4-dimethylpyrrolidin-3-yl]pyrrolidine-1-sulfonamide is sourced from PubChem (CID 98775179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).