C12H25N3O2S — CID 43209653
N-(2,3-dimethylcyclohexyl)piperazine-1-sulfonamide (PubChem CID 43209653) has the molecular formula C12H25N3O2S and a molecular weight of 275.42 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)piperazine-1-sulfonamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 43209653 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)piperazine-1-sulfonamide |
| SMILES | CC1CCCC(NS(=O)(=O)N2CCNCC2)C1C |
| InChI | InChI=1S/C12H25N3O2S/c1-10-4-3-5-12(11(10)2)14-18(16,17)15-8-6-13-7-9-15/h10-14H,3-9H2,1-2H3 |
| InChIKey | UXSNAFZWSIPMEE-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |