C15H27N3O2 — CID 43327567
2-(1,4-diazepan-1-yl)-N-(2,3-dimethylcyclohexyl)-2-oxoacetamide (PubChem CID 43327567) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-N-(2,3-dimethylcyclohexyl)-2-oxoacetamide.
| Compound Name | 2-(1,4-diazepan-1-yl)-N-(2,3-dimethylcyclohexyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 43327567 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-N-(2,3-dimethylcyclohexyl)-2-oxoacetamide |
| SMILES | CC1CCCC(NC(=O)C(=O)N2CCCNCC2)C1C |
| InChI | InChI=1S/C15H27N3O2/c1-11-5-3-6-13(12(11)2)17-14(19)15(20)18-9-4-7-16-8-10-18/h11-13,16H,3-10H2,1-2H3,(H,17,19) |
| InChIKey | NJSAXLNDLSKMSD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|