C10H17NO3 — CID 43445011
2-[(2,3-dimethylcyclohexyl)amino]-2-oxoacetic acid (PubChem CID 43445011) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-[(2,3-dimethylcyclohexyl)amino]-2-oxoacetic acid.
| Compound Name | 2-[(2,3-dimethylcyclohexyl)amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 43445011 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-[(2,3-dimethylcyclohexyl)amino]-2-oxoacetic acid |
| SMILES | CC1CCCC(NC(=O)C(=O)O)C1C |
| InChI | InChI=1S/C10H17NO3/c1-6-4-3-5-8(7(6)2)11-9(12)10(13)14/h6-8H,3-5H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | PXMHFXBUVDWBJS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|