C13H16ClNO5S — CID 41091374
N-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3,4-dimethoxybenzamide (PubChem CID 41091374) has the molecular formula C13H16ClNO5S and a molecular weight of 333.79 g/mol. Its IUPAC name is N-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3,4-dimethoxybenzamide.
| Compound Name | N-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 41091374 |
| Molecular Formula | C13H16ClNO5S |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-[(3R,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2CS(=O)(=O)C[C@H]2Cl)cc1OC |
| InChI | InChI=1S/C13H16ClNO5S/c1-19-11-4-3-8(5-12(11)20-2)13(16)15-10-7-21(17,18)6-9(10)14/h3-5,9-10H,6-7H2,1-2H3,(H,15,16)/t9-,10-/m1/s1 |
| InChIKey | JANCVCQSFISMIQ-NXEZZACHSA-N |
| XLogP | 0.84 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|