C12H17N3O3S — CID 47164063
2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-pyridin-2-ylacetamide (PubChem CID 47164063) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-pyridin-2-ylacetamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 47164063 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-pyridin-2-ylacetamide |
| SMILES | CN(CC(=O)Nc1ccccn1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H17N3O3S/c1-15(10-5-7-19(17,18)9-10)8-12(16)14-11-4-2-3-6-13-11/h2-4,6,10H,5,7-9H2,1H3,(H,13,14,16) |
| InChIKey | KKXLYGDEWHOQEE-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |