C18H23N3O4S — CID 131919717
2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-(2-quinolin-8-yloxyethyl)acetamide (PubChem CID 131919717) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-(2-quinolin-8-yloxyethyl)acetamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-(2-quinolin-8-yloxyethyl)acetamide |
|---|---|
| PubChem CID | 131919717 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-methylamino]-N-(2-quinolin-8-yloxyethyl)acetamide |
| SMILES | CN(CC(=O)NCCOc1cccc2cccnc12)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H23N3O4S/c1-21(15-7-11-26(23,24)13-15)12-17(22)19-9-10-25-16-6-2-4-14-5-3-8-20-18(14)16/h2-6,8,15H,7,9-13H2,1H3,(H,19,22) |
| InChIKey | UZWJLEOMQCHRCB-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|