C11H12ClFN2O — CID 104786596
N-(2-chloro-2-cyclopropylethyl)-5-fluoropyridine-3-carboxamide (PubChem CID 104786596) has the molecular formula C11H12ClFN2O and a molecular weight of 242.68 g/mol. Its IUPAC name is N-(2-chloro-2-cyclopropylethyl)-5-fluoropyridine-3-carboxamide.
| Compound Name | N-(2-chloro-2-cyclopropylethyl)-5-fluoropyridine-3-carboxamide |
|---|---|
| PubChem CID | 104786596 |
| Molecular Formula | C11H12ClFN2O |
| Molecular Weight | 242.68 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | N-(2-chloro-2-cyclopropylethyl)-5-fluoropyridine-3-carboxamide |
| SMILES | O=C(NCC(Cl)C1CC1)c1cncc(F)c1 |
| InChI | InChI=1S/C11H12ClFN2O/c12-10(7-1-2-7)6-15-11(16)8-3-9(13)5-14-4-8/h3-5,7,10H,1-2,6H2,(H,15,16) |
| InChIKey | HVPZLOZYDJSAAD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.68 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|