C10H12ClNO2 — CID 114305001
N-(2-chloro-2-cyclopropylethyl)furan-3-carboxamide (PubChem CID 114305001) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is N-(2-chloro-2-cyclopropylethyl)furan-3-carboxamide.
| Compound Name | N-(2-chloro-2-cyclopropylethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 114305001 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | N-(2-chloro-2-cyclopropylethyl)furan-3-carboxamide |
| SMILES | O=C(NCC(Cl)C1CC1)c1ccoc1 |
| InChI | InChI=1S/C10H12ClNO2/c11-9(7-1-2-7)5-12-10(13)8-3-4-14-6-8/h3-4,6-7,9H,1-2,5H2,(H,12,13) |
| InChIKey | AJCWGMSZRDSCRL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|